Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1-Hydroxycyclohexyl Phenyl Ketone 98.0+%, TCI America™
CAS: 947-19-3 Molecular Formula: C13H16O2 Molecular Weight (g/mol): 204.269 MDL Number: MFCD00059561 InChI Key: QNODIIQQMGDSEF-UHFFFAOYSA-N Synonym: 1-hydroxycyclohexyl phenyl ketone,1-hydroxycyclohexyl phenyl methanone,1-benzoylcyclohexanol,hydroxycyclohexyl phenyl ketone,1-benzoylcyclohexan-1-ol,irgacure 184,methanone, 1-hydroxycyclohexyl phenyl,unii-e7jvn2243x,1-hydroxycyclohexyl-phenylmethanone,1-cyclohexylhydroxyphenylketone PubChem CID: 70355 IUPAC Name: (1-hydroxycyclohexyl)-phenylmethanone SMILES: C1CCC(CC1)(C(=O)C2=CC=CC=C2)O
| PubChem CID | 70355 |
|---|---|
| CAS | 947-19-3 |
| Molecular Weight (g/mol) | 204.269 |
| MDL Number | MFCD00059561 |
| SMILES | C1CCC(CC1)(C(=O)C2=CC=CC=C2)O |
| Synonym | 1-hydroxycyclohexyl phenyl ketone,1-hydroxycyclohexyl phenyl methanone,1-benzoylcyclohexanol,hydroxycyclohexyl phenyl ketone,1-benzoylcyclohexan-1-ol,irgacure 184,methanone, 1-hydroxycyclohexyl phenyl,unii-e7jvn2243x,1-hydroxycyclohexyl-phenylmethanone,1-cyclohexylhydroxyphenylketone |
| IUPAC Name | (1-hydroxycyclohexyl)-phenylmethanone |
| InChI Key | QNODIIQQMGDSEF-UHFFFAOYSA-N |
| Molecular Formula | C13H16O2 |
Acetovanillone, 98%
CAS: 498-02-2 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00008747 InChI Key: DFYRUELUNQRZTB-UHFFFAOYSA-N Synonym: acetovanillone,apocynin,4'-hydroxy-3'-methoxyacetophenone,1-4-hydroxy-3-methoxyphenyl ethanone,acetoguaiacone,acetoguaiacon,apocynine,4-acetyl-2-methoxyphenol,acetovanilone,acetovanyllon PubChem CID: 2214 ChEBI: CHEBI:2781 IUPAC Name: 1-(4-hydroxy-3-methoxyphenyl)ethanone SMILES: COC1=CC(=CC=C1O)C(C)=O
| PubChem CID | 2214 |
|---|---|
| CAS | 498-02-2 |
| Molecular Weight (g/mol) | 166.18 |
| ChEBI | CHEBI:2781 |
| MDL Number | MFCD00008747 |
| SMILES | COC1=CC(=CC=C1O)C(C)=O |
| Synonym | acetovanillone,apocynin,4'-hydroxy-3'-methoxyacetophenone,1-4-hydroxy-3-methoxyphenyl ethanone,acetoguaiacone,acetoguaiacon,apocynine,4-acetyl-2-methoxyphenol,acetovanilone,acetovanyllon |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)ethanone |
| InChI Key | DFYRUELUNQRZTB-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
3,5-Dihydroxybenzoic acid, 97%
CAS: 99-10-5 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.12 MDL Number: MFCD00002512 InChI Key: UYEMGAFJOZZIFP-UHFFFAOYSA-N Synonym: alpha-resorcylic acid,5-carboxyresorcinol,benzoic acid, 3,5-dihydroxy,unii-2wc5lmo6l1,3,5-dihydroxy benzoic acid,3,5-dihydroxy-benzoic acid,3,5-dhba,3,5-dihydroxybenzoicacid,a-resorcylic acid,.alpha.-resorcylic acid PubChem CID: 7424 ChEBI: CHEBI:39912 IUPAC Name: 3,5-dihydroxybenzoic acid SMILES: OC(=O)C1=CC(O)=CC(O)=C1
| PubChem CID | 7424 |
|---|---|
| CAS | 99-10-5 |
| Molecular Weight (g/mol) | 154.12 |
| ChEBI | CHEBI:39912 |
| MDL Number | MFCD00002512 |
| SMILES | OC(=O)C1=CC(O)=CC(O)=C1 |
| Synonym | alpha-resorcylic acid,5-carboxyresorcinol,benzoic acid, 3,5-dihydroxy,unii-2wc5lmo6l1,3,5-dihydroxy benzoic acid,3,5-dihydroxy-benzoic acid,3,5-dhba,3,5-dihydroxybenzoicacid,a-resorcylic acid,.alpha.-resorcylic acid |
| IUPAC Name | 3,5-dihydroxybenzoic acid |
| InChI Key | UYEMGAFJOZZIFP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
3,5-Dichlorobenzylamine, 94%
CAS: 39989-43-0 Molecular Formula: C7H7Cl2N Molecular Weight (g/mol): 176.04 MDL Number: MFCD00052681 InChI Key: ICIJWOWQUHHETJ-UHFFFAOYSA-N Synonym: 3,5-dichlorobenzylamine,3,5-dichlorophenyl methanamine,benzenemethanamine, 3,5-dichloro,3,5-dichloro-benzylamine,1-3,5-dichlorophenyl methanamine,3,5-dichlorophenyl methylamine,pubchem23431,3.5-dichlorobenzylamine,acmc-1cthv,integrase inhibitor, r1 4 PubChem CID: 457602 SMILES: NCC1=CC(Cl)=CC(Cl)=C1
| PubChem CID | 457602 |
|---|---|
| CAS | 39989-43-0 |
| Molecular Weight (g/mol) | 176.04 |
| MDL Number | MFCD00052681 |
| SMILES | NCC1=CC(Cl)=CC(Cl)=C1 |
| Synonym | 3,5-dichlorobenzylamine,3,5-dichlorophenyl methanamine,benzenemethanamine, 3,5-dichloro,3,5-dichloro-benzylamine,1-3,5-dichlorophenyl methanamine,3,5-dichlorophenyl methylamine,pubchem23431,3.5-dichlorobenzylamine,acmc-1cthv,integrase inhibitor, r1 4 |
| InChI Key | ICIJWOWQUHHETJ-UHFFFAOYSA-N |
| Molecular Formula | C7H7Cl2N |
Gibberellic Acid, 90%
CAS: 77-06-5 Molecular Formula: C19H22O6 Molecular Weight (g/mol): 346.38 MDL Number: MFCD00079329 InChI Key: IXORZMNAPKEEDV-QTWFBFKQSA-N Synonym: gibberellic acid,gibberellin a3,gibberellin,gibreskol,brellin,cekugib,grocel,gibberellin x,gibberellic acid ga3,gib-tabs PubChem CID: 91757643 IUPAC Name: (1R,2R,5S,8S,9S,10R,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1⁵,⁸.0¹,¹⁰.0²,⁸]heptadec-13-ene-9-carboxylic acid SMILES: CC12[C@H]3[C@H](C(O)=O)[C@@]45CC(=C)[C@@](O)(C4)CC[C@H]5[C@]3(OC1=O)C=C[C@@H]2O
| PubChem CID | 91757643 |
|---|---|
| CAS | 77-06-5 |
| Molecular Weight (g/mol) | 346.38 |
| MDL Number | MFCD00079329 |
| SMILES | CC12[C@H]3[C@H](C(O)=O)[C@@]45CC(=C)[C@@](O)(C4)CC[C@H]5[C@]3(OC1=O)C=C[C@@H]2O |
| Synonym | gibberellic acid,gibberellin a3,gibberellin,gibreskol,brellin,cekugib,grocel,gibberellin x,gibberellic acid ga3,gib-tabs |
| IUPAC Name | (1R,2R,5S,8S,9S,10R,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1⁵,⁸.0¹,¹⁰.0²,⁸]heptadec-13-ene-9-carboxylic acid |
| InChI Key | IXORZMNAPKEEDV-QTWFBFKQSA-N |
| Molecular Formula | C19H22O6 |
Cyanuric chloride, 99%
CAS: 108-77-0 Molecular Formula: C3Cl3N3 Molecular Weight (g/mol): 184.40 MDL Number: MFCD00006046 InChI Key: MGNCLNQXLYJVJD-UHFFFAOYSA-N Synonym: cyanuric chloride,cyanuryl chloride,cyanuric acid chloride,s-triazine trichloride,trichlorocyanidine,cyanuric trichloride,tricyanogen chloride,sym-trichlorotriazine,cyanur chloride,trichloro-s-triazine PubChem CID: 7954 ChEBI: CHEBI:58964 SMILES: ClC1=NC(Cl)=NC(Cl)=N1
| PubChem CID | 7954 |
|---|---|
| CAS | 108-77-0 |
| Molecular Weight (g/mol) | 184.40 |
| ChEBI | CHEBI:58964 |
| MDL Number | MFCD00006046 |
| SMILES | ClC1=NC(Cl)=NC(Cl)=N1 |
| Synonym | cyanuric chloride,cyanuryl chloride,cyanuric acid chloride,s-triazine trichloride,trichlorocyanidine,cyanuric trichloride,tricyanogen chloride,sym-trichlorotriazine,cyanur chloride,trichloro-s-triazine |
| InChI Key | MGNCLNQXLYJVJD-UHFFFAOYSA-N |
| Molecular Formula | C3Cl3N3 |
Potassium citrate tribasic monohydrate, 99%, extra pure
CAS: 6100-05-6 Molecular Formula: C6H5K3O7·H2O Molecular Weight (g/mol): 324.42 InChI Key: PJAHUDTUZRZBKM-UHFFFAOYSA-K Synonym: potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate PubChem CID: 2735208 ChEBI: CHEBI:64746 IUPAC Name: tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+]
| PubChem CID | 2735208 |
|---|---|
| CAS | 6100-05-6 |
| Molecular Weight (g/mol) | 324.42 |
| ChEBI | CHEBI:64746 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+] |
| Synonym | potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate |
| IUPAC Name | tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
| InChI Key | PJAHUDTUZRZBKM-UHFFFAOYSA-K |
| Molecular Formula | C6H5K3O7·H2O |
Sodium triacetoxyborohydride, 97%
CAS: 56553-60-7 Molecular Formula: C6H10BNaO6 Molecular Weight (g/mol): 211.94 MDL Number: MFCD00012211 InChI Key: HHYFEYBWNZJVFQ-UHFFFAOYSA-N Synonym: c6h10bnao6,sodium triacetoxyboron 1-,pubchem12871,sodium triacetoxy borohyride,sodium triacetyloxyboron 1-,tris acetoxy hydroborate sodium salt,sodium bis acetyloxy-$l^ 2-boranuidyl acetate IUPAC Name: sodium bis(acetyloxy)boranuidyl acetate SMILES: [Na+].CC(=O)O[BH-](OC(C)=O)OC(C)=O
| CAS | 56553-60-7 |
|---|---|
| Molecular Weight (g/mol) | 211.94 |
| MDL Number | MFCD00012211 |
| SMILES | [Na+].CC(=O)O[BH-](OC(C)=O)OC(C)=O |
| Synonym | c6h10bnao6,sodium triacetoxyboron 1-,pubchem12871,sodium triacetoxy borohyride,sodium triacetyloxyboron 1-,tris acetoxy hydroborate sodium salt,sodium bis acetyloxy-$l^ 2-boranuidyl acetate |
| IUPAC Name | sodium bis(acetyloxy)boranuidyl acetate |
| InChI Key | HHYFEYBWNZJVFQ-UHFFFAOYSA-N |
| Molecular Formula | C6H10BNaO6 |
Sulfur trioxide-trimethylamine complex, 95%
CAS: 3162-58-1 Molecular Formula: C3H9NO3S Molecular Weight (g/mol): 139.17 MDL Number: MFCD00012421 InChI Key: DXASQZJWWGZNSF-UHFFFAOYSA-N Synonym: sulfur trioxide trimethylamine complex,sulfur trioxide trimethylamine,sulfur trioxide-trimethylamine complex,sulphur trioxide trimethylamine 1:1,sulfur trioxide-trimethylamine,trimethylamine sulfur trioxide,sulfur trioxide; trimethylamine,1n1&1&&so3 complex,trimethylamine, compd. with sulfur trioxide 1:1,trimethylamine, compound with sulphur trioxide PubChem CID: 222852 IUPAC Name: N,N-dimethylmethanamine;sulfur trioxide SMILES: CN(C)C.O=S(=O)=O
| PubChem CID | 222852 |
|---|---|
| CAS | 3162-58-1 |
| Molecular Weight (g/mol) | 139.17 |
| MDL Number | MFCD00012421 |
| SMILES | CN(C)C.O=S(=O)=O |
| Synonym | sulfur trioxide trimethylamine complex,sulfur trioxide trimethylamine,sulfur trioxide-trimethylamine complex,sulphur trioxide trimethylamine 1:1,sulfur trioxide-trimethylamine,trimethylamine sulfur trioxide,sulfur trioxide; trimethylamine,1n1&1&&so3 complex,trimethylamine, compd. with sulfur trioxide 1:1,trimethylamine, compound with sulphur trioxide |
| IUPAC Name | N,N-dimethylmethanamine;sulfur trioxide |
| InChI Key | DXASQZJWWGZNSF-UHFFFAOYSA-N |
| Molecular Formula | C3H9NO3S |
N,N-Diethyl-p-phenylenediamine sulfate, 99%
CAS: 6283-63-2 Molecular Formula: C10H16N2·H2SO4 Molecular Weight (g/mol): 262.33 MDL Number: MFCD00012993 InChI Key: AYLDJQABCMPYEN-UHFFFAOYSA-N Synonym: n,n-diethyl-p-phenylenediamine sulfate,n1,n1-diethylbenzene-1,4-diamine sulfate,4-amino-n,n-diethylaniline sulfate,diethyl-p-phenylenediamine sulfate,n,n-diethyl-1,4-phenylenediamine sulfate,unii-usp19t3gda,1,4-benzenediamine, n,n-diethyl-, sulfate 1:1,1,4-benzenediamine, n,n-diethyl-, sulfate,n,n-diethyl-1,4-benzenediamine sulfate,p-phenylenediamine, n,n-diethyl-, sulfate 1:1 PubChem CID: 80166 IUPAC Name: 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid SMILES: CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O
| PubChem CID | 80166 |
|---|---|
| CAS | 6283-63-2 |
| Molecular Weight (g/mol) | 262.33 |
| MDL Number | MFCD00012993 |
| SMILES | CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O |
| Synonym | n,n-diethyl-p-phenylenediamine sulfate,n1,n1-diethylbenzene-1,4-diamine sulfate,4-amino-n,n-diethylaniline sulfate,diethyl-p-phenylenediamine sulfate,n,n-diethyl-1,4-phenylenediamine sulfate,unii-usp19t3gda,1,4-benzenediamine, n,n-diethyl-, sulfate 1:1,1,4-benzenediamine, n,n-diethyl-, sulfate,n,n-diethyl-1,4-benzenediamine sulfate,p-phenylenediamine, n,n-diethyl-, sulfate 1:1 |
| IUPAC Name | 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid |
| InChI Key | AYLDJQABCMPYEN-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2·H2SO4 |
Amlodipine Besylate 98.0+%, TCI America™
CAS: 111470-99-6 Molecular Formula: C26H31ClN2O8S Molecular Weight (g/mol): 567.05 MDL Number: MFCD00887594 InChI Key: ZPBWCRDSRKPIDG-UHFFFAOYSA-N Synonym: amlodipine besylate,amlodipine besilate,cardiorex,amlodipine benzenesulfonate,istin,amdepin,amdipin,amlodin,amlogard,amlopin PubChem CID: 60496 ChEBI: CHEBI:2669 IUPAC Name: benzenesulfonic acid;3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate SMILES: CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN.C1=CC=C(C=C1)S(=O)(=O)O
| PubChem CID | 60496 |
|---|---|
| CAS | 111470-99-6 |
| Molecular Weight (g/mol) | 567.05 |
| ChEBI | CHEBI:2669 |
| MDL Number | MFCD00887594 |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN.C1=CC=C(C=C1)S(=O)(=O)O |
| Synonym | amlodipine besylate,amlodipine besilate,cardiorex,amlodipine benzenesulfonate,istin,amdepin,amdipin,amlodin,amlogard,amlopin |
| IUPAC Name | benzenesulfonic acid;3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI Key | ZPBWCRDSRKPIDG-UHFFFAOYSA-N |
| Molecular Formula | C26H31ClN2O8S |
1-Tetradecanol, 97+%
CAS: 112-72-1 Molecular Formula: C14H30O Molecular Weight (g/mol): 214.39 MDL Number: MFCD00004757 InChI Key: HLZKNKRTKFSKGZ-UHFFFAOYSA-N Synonym: 1-tetradecanol,myristyl alcohol,tetradecanol,tetradecyl alcohol,n-tetradecanol,myristic alcohol,n-tetradecyl alcohol,lanette k,loxanol v,lanette wax ks PubChem CID: 8209 ChEBI: CHEBI:77417 IUPAC Name: tetradecan-1-ol SMILES: CCCCCCCCCCCCCCO
| PubChem CID | 8209 |
|---|---|
| CAS | 112-72-1 |
| Molecular Weight (g/mol) | 214.39 |
| ChEBI | CHEBI:77417 |
| MDL Number | MFCD00004757 |
| SMILES | CCCCCCCCCCCCCCO |
| Synonym | 1-tetradecanol,myristyl alcohol,tetradecanol,tetradecyl alcohol,n-tetradecanol,myristic alcohol,n-tetradecyl alcohol,lanette k,loxanol v,lanette wax ks |
| IUPAC Name | tetradecan-1-ol |
| InChI Key | HLZKNKRTKFSKGZ-UHFFFAOYSA-N |
| Molecular Formula | C14H30O |
1,10-Phenanthroline-5,6-dione, 98%
CAS: 27318-90-7 Molecular Formula: C12H6N2O2 Molecular Weight (g/mol): 210.19 MDL Number: MFCD00014473 InChI Key: KCALAFIVPCAXJI-UHFFFAOYSA-N Synonym: 1,10 phenanthroline-5,6-dione,1 10-phenanthroline-5 6-dione 97,pyridino 3,2-h quinoline-5,6-dione,phen-5,6-dione,pubchem16755,acmc-209gwd,d0jh7c,phox31,ksc204s8l,1,2-dione-based compound, 17 PubChem CID: 72810 IUPAC Name: 1,10-phenanthroline-5,6-dione SMILES: O=C1C(=O)C2=CC=CN=C2C2=NC=CC=C12
| PubChem CID | 72810 |
|---|---|
| CAS | 27318-90-7 |
| Molecular Weight (g/mol) | 210.19 |
| MDL Number | MFCD00014473 |
| SMILES | O=C1C(=O)C2=CC=CN=C2C2=NC=CC=C12 |
| Synonym | 1,10 phenanthroline-5,6-dione,1 10-phenanthroline-5 6-dione 97,pyridino 3,2-h quinoline-5,6-dione,phen-5,6-dione,pubchem16755,acmc-209gwd,d0jh7c,phox31,ksc204s8l,1,2-dione-based compound, 17 |
| IUPAC Name | 1,10-phenanthroline-5,6-dione |
| InChI Key | KCALAFIVPCAXJI-UHFFFAOYSA-N |
| Molecular Formula | C12H6N2O2 |
2-Hydroxyisobutyric acid, 99% (dry wt.), water <2%
CAS: 594-61-6 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.11 MDL Number: MFCD00004459 InChI Key: BWLBGMIXKSTLSX-UHFFFAOYSA-N Synonym: 2-hydroxyisobutyric acid,2-methyllactic acid,acetonic acid,2-hydroxy-2-methylpropionic acid,alpha-hydroxyisobutyric acid,hydroxydimethylacetic acid,acetonate,propanoic acid, 2-hydroxy-2-methyl,alpha-hydroxyisobutanoic acid,2-hydroxyisobutyricacid PubChem CID: 11671 ChEBI: CHEBI:50129 IUPAC Name: 2-hydroxy-2-methylpropanoic acid SMILES: CC(C)(O)C(O)=O
| PubChem CID | 11671 |
|---|---|
| CAS | 594-61-6 |
| Molecular Weight (g/mol) | 104.11 |
| ChEBI | CHEBI:50129 |
| MDL Number | MFCD00004459 |
| SMILES | CC(C)(O)C(O)=O |
| Synonym | 2-hydroxyisobutyric acid,2-methyllactic acid,acetonic acid,2-hydroxy-2-methylpropionic acid,alpha-hydroxyisobutyric acid,hydroxydimethylacetic acid,acetonate,propanoic acid, 2-hydroxy-2-methyl,alpha-hydroxyisobutanoic acid,2-hydroxyisobutyricacid |
| IUPAC Name | 2-hydroxy-2-methylpropanoic acid |
| InChI Key | BWLBGMIXKSTLSX-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3 |
Glutaric acid, 99%
CAS: 110-94-1 Molecular Formula: C5H8O4 Molecular Weight (g/mol): 132.12 MDL Number: MFCD00004410 InChI Key: JFCQEDHGNNZCLN-UHFFFAOYSA-N Synonym: glutaric acid,1,5-pentanedioic acid,1,3-propanedicarboxylic acid,pentandioic acid,glutarate,n-pyrotartaric acid,unii-h849f7n00b,propane-1,3-dicarboxylic acid,c4-c6 dibasic acids,carboxylic acids, c6-18 and c5-15-di PubChem CID: 743 ChEBI: CHEBI:17859 IUPAC Name: pentanedioic acid SMILES: OC(=O)CCCC(O)=O
| PubChem CID | 743 |
|---|---|
| CAS | 110-94-1 |
| Molecular Weight (g/mol) | 132.12 |
| ChEBI | CHEBI:17859 |
| MDL Number | MFCD00004410 |
| SMILES | OC(=O)CCCC(O)=O |
| Synonym | glutaric acid,1,5-pentanedioic acid,1,3-propanedicarboxylic acid,pentandioic acid,glutarate,n-pyrotartaric acid,unii-h849f7n00b,propane-1,3-dicarboxylic acid,c4-c6 dibasic acids,carboxylic acids, c6-18 and c5-15-di |
| IUPAC Name | pentanedioic acid |
| InChI Key | JFCQEDHGNNZCLN-UHFFFAOYSA-N |
| Molecular Formula | C5H8O4 |