Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Thermo Scientific Chemicals N-Acetyl-D-glucosamine, 98+%
CAS: 7512-17-6 Molecular Formula: C8H15NO6 Molecular Weight (g/mol): 221.21 MDL Number: MFCD00061615 InChI Key: OVRNDRQMDRJTHS-WZWLWIOANA-N IUPAC Name: N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide SMILES: CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O
| CAS | 7512-17-6 |
|---|---|
| Molecular Weight (g/mol) | 221.21 |
| MDL Number | MFCD00061615 |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| IUPAC Name | N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| InChI Key | OVRNDRQMDRJTHS-WZWLWIOANA-N |
| Molecular Formula | C8H15NO6 |
TES, 99%
CAS: 7365-44-8 Molecular Formula: C6H15NO6S Molecular Weight (g/mol): 229.247 MDL Number: MFCD00007532 InChI Key: JOCBASBOOFNAJA-UHFFFAOYSA-N Synonym: tes,n-tris hydroxymethyl methyl-2-aminoethanesulfonic acid,tes buffer,tes free acid,ethanesulfonic acid, 2-2-hydroxy-1,1-bis hydroxymethyl ethyl amino,2-1,3-dihydroxy-2-hydroxymethyl propan-2-yl amino ethanesulfonic acid,2-2-hydroxy-1,1-dihydroxymethyl-ethylamino-ethanesulfonic acid,tris hydroxymethyl methyl-2-aminomethane sulfonic acid,2-tris hydroxymethyl methylamino ethane-1-sulphonic acid,n-tri hydroxymethyl methyltaurine PubChem CID: 81831 ChEBI: CHEBI:44356 IUPAC Name: 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonic acid SMILES: C(CS(=O)(=O)O)NC(CO)(CO)CO
| PubChem CID | 81831 |
|---|---|
| CAS | 7365-44-8 |
| Molecular Weight (g/mol) | 229.247 |
| ChEBI | CHEBI:44356 |
| MDL Number | MFCD00007532 |
| SMILES | C(CS(=O)(=O)O)NC(CO)(CO)CO |
| Synonym | tes,n-tris hydroxymethyl methyl-2-aminoethanesulfonic acid,tes buffer,tes free acid,ethanesulfonic acid, 2-2-hydroxy-1,1-bis hydroxymethyl ethyl amino,2-1,3-dihydroxy-2-hydroxymethyl propan-2-yl amino ethanesulfonic acid,2-2-hydroxy-1,1-dihydroxymethyl-ethylamino-ethanesulfonic acid,tris hydroxymethyl methyl-2-aminomethane sulfonic acid,2-tris hydroxymethyl methylamino ethane-1-sulphonic acid,n-tri hydroxymethyl methyltaurine |
| IUPAC Name | 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonic acid |
| InChI Key | JOCBASBOOFNAJA-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO6S |
Sodium formate, ACS, 99.0% min
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.007 MDL Number: MFCD00013101 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.007 |
| ChEBI | CHEBI:62965 |
| MDL Number | MFCD00013101 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
Dimethylamine hydrochloride, 99%, Thermo Scientific Chemicals
CAS: 506-59-2 MDL Number: MFCD00012477 InChI Key: IQDGSYLLQPDQDV-UHFFFAOYSA-N Synonym: dimethylamine hydrochloride,n-methylmethanamine hydrochloride,dimethylammonium chloride,methanamine, n-methyl-, hydrochloride,dimethylamine hcl,dimethylaminehydrochloride,unii-7m4cwb6aok,dimethylamine, hydrochloride,hydrochloric acid dimethylamine,n,n-dimethylamine hydrochloride PubChem CID: 10473
| PubChem CID | 10473 |
|---|---|
| CAS | 506-59-2 |
| MDL Number | MFCD00012477 |
| Synonym | dimethylamine hydrochloride,n-methylmethanamine hydrochloride,dimethylammonium chloride,methanamine, n-methyl-, hydrochloride,dimethylamine hcl,dimethylaminehydrochloride,unii-7m4cwb6aok,dimethylamine, hydrochloride,hydrochloric acid dimethylamine,n,n-dimethylamine hydrochloride |
| InChI Key | IQDGSYLLQPDQDV-UHFFFAOYSA-N |
Serotonin creatinine sulfate monohydrate, 99%
CAS: 61-47-2 Molecular Formula: H2SO4·H2O Molecular Weight (g/mol): 405.42 MDL Number: MFCD00149653 InChI Key: BKCXVJIGPVULPX-UHFFFAOYSA-N Synonym: serotonin creatinine sulfate monohydrate,serotonin creatinin-sulfat-1-wasser,unii-6l522laq9u,serotonin creatine sulfate monohydrate,creatinina serotonin sulfuric acid hydrate,1-benzo b thien-3-yl-3-1-pyrrolidinyl-1-propanone hydrochloride,1-propanone, 1-benzo b thien-3-yl-3-1-pyrrolidinyl-, hydrochloride,sulfuric acid compound with 2-imino-1-methylimidazolidin-4-one and 3-2-aminoethyl-1h-indol-5-ol 1:1:1 hydrate,ccris 8960,serotonincreatininesulfatemonohydrate PubChem CID: 164531 IUPAC Name: 3-(2-aminoethyl)-1H-indol-5-ol;2-amino-3-methyl-4H-imidazol-5-one;sulfuric acid;hydrate SMILES: CN1CC(=O)N=C1N.C1=CC2=C(C=C1O)C(=CN2)CCN.O.OS(=O)(=O)O
| PubChem CID | 164531 |
|---|---|
| CAS | 61-47-2 |
| Molecular Weight (g/mol) | 405.42 |
| MDL Number | MFCD00149653 |
| SMILES | CN1CC(=O)N=C1N.C1=CC2=C(C=C1O)C(=CN2)CCN.O.OS(=O)(=O)O |
| Synonym | serotonin creatinine sulfate monohydrate,serotonin creatinin-sulfat-1-wasser,unii-6l522laq9u,serotonin creatine sulfate monohydrate,creatinina serotonin sulfuric acid hydrate,1-benzo b thien-3-yl-3-1-pyrrolidinyl-1-propanone hydrochloride,1-propanone, 1-benzo b thien-3-yl-3-1-pyrrolidinyl-, hydrochloride,sulfuric acid compound with 2-imino-1-methylimidazolidin-4-one and 3-2-aminoethyl-1h-indol-5-ol 1:1:1 hydrate,ccris 8960,serotonincreatininesulfatemonohydrate |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;2-amino-3-methyl-4H-imidazol-5-one;sulfuric acid;hydrate |
| InChI Key | BKCXVJIGPVULPX-UHFFFAOYSA-N |
| Molecular Formula | H2SO4·H2O |
Phenylmagnesium bromide, 1.6M solution in CPME, AcroSeal™
CAS: 100-58-3 Molecular Formula: C6H5BrMg Molecular Weight (g/mol): 181.32 MDL Number: MFCD00000038 InChI Key: ANRQGKOBLBYXFM-UHFFFAOYSA-M Synonym: phenylmagnesium bromide,bromophenylmagnesium,magnesium, bromophenyl,phmgbr,phenylmagnesiumbromide,bromo phenyl magnesium,phenyl magnesium bromide,phenylmagnesium bromide solution, 3.0 m in diethyl ether,bromomagnesiobenzene,phenyhnagnesium bromide,grignard reagent PubChem CID: 66852 IUPAC Name: magnesium;benzene;bromide SMILES: Br[Mg]C1=CC=CC=C1
| PubChem CID | 66852 |
|---|---|
| CAS | 100-58-3 |
| Molecular Weight (g/mol) | 181.32 |
| MDL Number | MFCD00000038 |
| SMILES | Br[Mg]C1=CC=CC=C1 |
| Synonym | phenylmagnesium bromide,bromophenylmagnesium,magnesium, bromophenyl,phmgbr,phenylmagnesiumbromide,bromo phenyl magnesium,phenyl magnesium bromide,phenylmagnesium bromide solution, 3.0 m in diethyl ether,bromomagnesiobenzene,phenyhnagnesium bromide,grignard reagent |
| IUPAC Name | magnesium;benzene;bromide |
| InChI Key | ANRQGKOBLBYXFM-UHFFFAOYSA-M |
| Molecular Formula | C6H5BrMg |
Thermo Scientific Chemicals 4-(Dicyanomethylene)-2-methyl-6-(p-dimethylaminostyryl)-4H-pyran, 96+%
CAS: 51325-91-8 Molecular Formula: C19H17N3O Molecular Weight (g/mol): 303.35 MDL Number: MFCD00051341 InChI Key: YLYPIBBGWLKELC-RMKNXTFCSA-N Synonym: unii-9s1wxc1zgn,dcm dye,dcm1,9s1wxc1zgn,4-dicyanomethylene-2-methyl-6-4-dimethylaminostyryl-4h-pyran,4-dicyanomethylene-2-methyl-6-4-dimethylamino styryl-4h-pyran,e-2-2-4-dimethylamino styryl-6-methyl-4h-pyran-4-ylidene malononitrile,2-2-4-dimethylamino phenyl ethenyl-6-methyl-4h-pyran-4-ylidene propanedinitrile,2-2-4-dimethylamino styryl-6-methyl-4h-pyran-4-ylidene malononitrile PubChem CID: 688222 IUPAC Name: 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile SMILES: CC1=CC(=C(C#N)C#N)C=C(O1)C=CC2=CC=C(C=C2)N(C)C
| PubChem CID | 688222 |
|---|---|
| CAS | 51325-91-8 |
| Molecular Weight (g/mol) | 303.35 |
| MDL Number | MFCD00051341 |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(O1)C=CC2=CC=C(C=C2)N(C)C |
| Synonym | unii-9s1wxc1zgn,dcm dye,dcm1,9s1wxc1zgn,4-dicyanomethylene-2-methyl-6-4-dimethylaminostyryl-4h-pyran,4-dicyanomethylene-2-methyl-6-4-dimethylamino styryl-4h-pyran,e-2-2-4-dimethylamino styryl-6-methyl-4h-pyran-4-ylidene malononitrile,2-2-4-dimethylamino phenyl ethenyl-6-methyl-4h-pyran-4-ylidene propanedinitrile,2-2-4-dimethylamino styryl-6-methyl-4h-pyran-4-ylidene malononitrile |
| IUPAC Name | 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile |
| InChI Key | YLYPIBBGWLKELC-RMKNXTFCSA-N |
| Molecular Formula | C19H17N3O |
Hesperetin 97.0+%, TCI America™
CAS: 520-33-2 Molecular Formula: C16H14O6 Molecular Weight (g/mol): 302.28 MDL Number: MFCD00075646 InChI Key: AIONOLUJZLIMTK-AWEZNQCLSA-N Synonym: hesperetin,hesperitin,3',5,7-trihydroxy-4'-methoxyflavanone,hesperin,yso2,cyanidanon 4'-methyl ether 1626,5,7,3'-trihydroxy-4'-methoxyflavanone,--hesperetin,prestwick_908,unii-q9q3d557f1 PubChem CID: 72281 ChEBI: CHEBI:28230 IUPAC Name: (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one SMILES: COC1=CC=C(C=C1O)[C@@H]1CC(=O)C2=C(O)C=C(O)C=C2O1
| PubChem CID | 72281 |
|---|---|
| CAS | 520-33-2 |
| Molecular Weight (g/mol) | 302.28 |
| ChEBI | CHEBI:28230 |
| MDL Number | MFCD00075646 |
| SMILES | COC1=CC=C(C=C1O)[C@@H]1CC(=O)C2=C(O)C=C(O)C=C2O1 |
| Synonym | hesperetin,hesperitin,3',5,7-trihydroxy-4'-methoxyflavanone,hesperin,yso2,cyanidanon 4'-methyl ether 1626,5,7,3'-trihydroxy-4'-methoxyflavanone,--hesperetin,prestwick_908,unii-q9q3d557f1 |
| IUPAC Name | (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one |
| InChI Key | AIONOLUJZLIMTK-AWEZNQCLSA-N |
| Molecular Formula | C16H14O6 |
Triphenylphosphine, flake, 99%
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
2-Bromobutane, 98%
CAS: 78-76-2 Molecular Formula: C4H9Br Molecular Weight (g/mol): 137.02 MDL Number: MFCD00000156 InChI Key: UPSXAPQYNGXVBF-UHFFFAOYSA-N Synonym: sec-butyl bromide,butane, 2-bromo,2-butyl bromide,methylethylbromomethane,2-bromo-butane,secondary butyl bromide,sec-butylbromide,1-bromo-1-methylpropane,ccris 106,bromobutane, 2 PubChem CID: 6554 IUPAC Name: 2-bromobutane SMILES: CCC(C)Br
| PubChem CID | 6554 |
|---|---|
| CAS | 78-76-2 |
| Molecular Weight (g/mol) | 137.02 |
| MDL Number | MFCD00000156 |
| SMILES | CCC(C)Br |
| Synonym | sec-butyl bromide,butane, 2-bromo,2-butyl bromide,methylethylbromomethane,2-bromo-butane,secondary butyl bromide,sec-butylbromide,1-bromo-1-methylpropane,ccris 106,bromobutane, 2 |
| IUPAC Name | 2-bromobutane |
| InChI Key | UPSXAPQYNGXVBF-UHFFFAOYSA-N |
| Molecular Formula | C4H9Br |
Diphenylmethane, 99+%
CAS: 101-81-5 Molecular Formula: C13H12 Molecular Weight (g/mol): 168.24 MDL Number: MFCD00004781 InChI Key: CZZYITDELCSZES-UHFFFAOYSA-N Synonym: diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene PubChem CID: 7580 ChEBI: CHEBI:38884 IUPAC Name: benzylbenzene SMILES: C(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 7580 |
|---|---|
| CAS | 101-81-5 |
| Molecular Weight (g/mol) | 168.24 |
| ChEBI | CHEBI:38884 |
| MDL Number | MFCD00004781 |
| SMILES | C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene |
| IUPAC Name | benzylbenzene |
| InChI Key | CZZYITDELCSZES-UHFFFAOYSA-N |
| Molecular Formula | C13H12 |
1-Bromo-3-phenoxypropane, 98%
CAS: 588-63-6 Molecular Formula: C9H11BrO Molecular Weight (g/mol): 215.09 MDL Number: MFCD00000256 InChI Key: NIDWUZTTXGJFNN-UHFFFAOYSA-N Synonym: 3-bromopropoxy benzene,3-phenoxypropyl bromide,benzene, 3-bromopropoxy,3-bromopropyl phenyl ether,1-bromo-3-phenoxypropane,ether, 3-bromopropyl phenyl,gamma-phenoxypropyl bromide,phenoxypropyl bromide,3-bromo-1-phenoxypropane,.gamma.-phenoxypropyl bromide PubChem CID: 68522 IUPAC Name: 3-bromopropoxybenzene SMILES: BrCCCOC1=CC=CC=C1
| PubChem CID | 68522 |
|---|---|
| CAS | 588-63-6 |
| Molecular Weight (g/mol) | 215.09 |
| MDL Number | MFCD00000256 |
| SMILES | BrCCCOC1=CC=CC=C1 |
| Synonym | 3-bromopropoxy benzene,3-phenoxypropyl bromide,benzene, 3-bromopropoxy,3-bromopropyl phenyl ether,1-bromo-3-phenoxypropane,ether, 3-bromopropyl phenyl,gamma-phenoxypropyl bromide,phenoxypropyl bromide,3-bromo-1-phenoxypropane,.gamma.-phenoxypropyl bromide |
| IUPAC Name | 3-bromopropoxybenzene |
| InChI Key | NIDWUZTTXGJFNN-UHFFFAOYSA-N |
| Molecular Formula | C9H11BrO |
1,4-Bis(2-methylstyryl)benzene, 99%
CAS: 13280-61-0 Molecular Formula: C24H22 Molecular Weight (g/mol): 310.44 MDL Number: MFCD00008529 InChI Key: QKLPIYTUUFFRLV-YTEMWHBBSA-N Synonym: 1,4-bis 2-methylstyryl benzene,bis-msb,p-bis o-methylstyryl benzene,benzene, 1,4-bis 2-2-methylphenyl ethenyl,1,4-di 2-methylstyryl benzene,1,4-bis 2-methylstyryl benzene bis-msb,benzene, p-bis o-methylstyryl,1,4-di-2-methylstyryl benzene,2-menthylstyrene,1-methyl-2-2-4-2-2-methylphenyl ethenyl phenyl ethenyl benzene PubChem CID: 5378735 IUPAC Name: 1,4-bis[(E)-2-(2-methylphenyl)ethenyl]benzene SMILES: CC1=CC=CC=C1C=CC2=CC=C(C=C2)C=CC3=CC=CC=C3C
| PubChem CID | 5378735 |
|---|---|
| CAS | 13280-61-0 |
| Molecular Weight (g/mol) | 310.44 |
| MDL Number | MFCD00008529 |
| SMILES | CC1=CC=CC=C1C=CC2=CC=C(C=C2)C=CC3=CC=CC=C3C |
| Synonym | 1,4-bis 2-methylstyryl benzene,bis-msb,p-bis o-methylstyryl benzene,benzene, 1,4-bis 2-2-methylphenyl ethenyl,1,4-di 2-methylstyryl benzene,1,4-bis 2-methylstyryl benzene bis-msb,benzene, p-bis o-methylstyryl,1,4-di-2-methylstyryl benzene,2-menthylstyrene,1-methyl-2-2-4-2-2-methylphenyl ethenyl phenyl ethenyl benzene |
| IUPAC Name | 1,4-bis[(E)-2-(2-methylphenyl)ethenyl]benzene |
| InChI Key | QKLPIYTUUFFRLV-YTEMWHBBSA-N |
| Molecular Formula | C24H22 |
Benzyl phenyl ether, 97%
CAS: 946-80-5 Molecular Formula: C13H12O Molecular Weight (g/mol): 184.238 MDL Number: MFCD00020660 InChI Key: BOTNYLSAWDQNEX-UHFFFAOYSA-N Synonym: benzyl phenyl ether,benzyloxy benzene,phenyl benzyl ether,benzene, phenoxymethyl,ether, benzyl phenyl,benzylphenylether,benzyloxy-benzene,benzyloxybenzene,unii-bue863n0l8,.alpha.-phenylanisole PubChem CID: 70352 IUPAC Name: phenoxymethylbenzene SMILES: C1=CC=C(C=C1)COC2=CC=CC=C2
| PubChem CID | 70352 |
|---|---|
| CAS | 946-80-5 |
| Molecular Weight (g/mol) | 184.238 |
| MDL Number | MFCD00020660 |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2 |
| Synonym | benzyl phenyl ether,benzyloxy benzene,phenyl benzyl ether,benzene, phenoxymethyl,ether, benzyl phenyl,benzylphenylether,benzyloxy-benzene,benzyloxybenzene,unii-bue863n0l8,.alpha.-phenylanisole |
| IUPAC Name | phenoxymethylbenzene |
| InChI Key | BOTNYLSAWDQNEX-UHFFFAOYSA-N |
| Molecular Formula | C13H12O |